C43H23Cl7N2 — CID 91001962
9-[4-[(4-carbazol-9-yl-2,6-dichlorophenyl)-(2,4,6-trichlorophenyl)methyl]-3,5-dichlorophenyl]carbazole (PubChem CID 91001962) has the molecular formula C43H23Cl7N2 and a molecular weight of 815.84 g/mol. Its IUPAC name is 9-[4-[(4-carbazol-9-yl-2,6-dichlorophenyl)-(2,4,6-trichlorophenyl)methyl]-3,5-dichlorophenyl]carbazole.
| Compound Name | 9-[4-[(4-carbazol-9-yl-2,6-dichlorophenyl)-(2,4,6-trichlorophenyl)methyl]-3,5-dichlorophenyl]carbazole |
|---|---|
| PubChem CID | 91001962 |
| Molecular Formula | C43H23Cl7N2 |
| Molecular Weight | 815.84 g/mol |
| Exact Mass | 811.97 |
| IUPAC Name | 9-[4-[(4-carbazol-9-yl-2,6-dichlorophenyl)-(2,4,6-trichlorophenyl)methyl]-3,5-dichlorophenyl]carbazole |
| SMILES | Clc1cc(Cl)c(C(c2c(Cl)cc(-n3c4ccccc4c4ccccc43)cc2Cl)c2c(Cl)cc(-n3c4ccccc4c4ccccc43)cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C43H23Cl7N2/c44-23-17-30(45)40(31(46)18-23)43(41-32(47)19-24(20-33(41)48)51-36-13-5-1-9-26(36)27-10-2-6-14-37(27)51)42-34(49)21-25(22-35(42)50)52-38-15-7-3-11-28(38)29-12-4-8-16-39(29)52/h1-22,43H |
| InChIKey | MACKATOAJGPGFF-UHFFFAOYSA-N |
| XLogP | 15.63 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.84 |
| LogP ≤ 5 | 15.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|