C27H42N4O — CID 91002928
3-butyl-1-methylindazole;ethane;3-(1-methylindazol-3-yl)propan-1-ol (PubChem CID 91002928) has the molecular formula C27H42N4O and a molecular weight of 438.66 g/mol. Its IUPAC name is 3-butyl-1-methylindazole;ethane;3-(1-methylindazol-3-yl)propan-1-ol.
| Compound Name | 3-butyl-1-methylindazole;ethane;3-(1-methylindazol-3-yl)propan-1-ol |
|---|---|
| PubChem CID | 91002928 |
| Molecular Formula | C27H42N4O |
| Molecular Weight | 438.66 g/mol |
| Exact Mass | 438.34 |
| IUPAC Name | 3-butyl-1-methylindazole;ethane;3-(1-methylindazol-3-yl)propan-1-ol |
| SMILES | CC.CC.CCCCc1nn(C)c2ccccc12.Cn1nc(CCCO)c2ccccc21 |
| InChI | InChI=1S/C12H16N2.C11H14N2O.2C2H6/c1-3-4-8-11-10-7-5-6-9-12(10)14(2)13-11;1-13-11-7-3-2-5-9(11)10(12-13)6-4-8-14;2*1-2/h5-7,9H,3-4,8H2,1-2H3;2-3,5,7,14H,4,6,8H2,1H3;2*1-2H3 |
| InChIKey | RJHQDONAILCOMU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.66 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |