C24H35N5O — CID 91005889
ethane;[4-[3-(methylamino)-2-pyridinyl]piperazin-1-yl]-(1-methylindol-2-yl)methanone (PubChem CID 91005889) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is ethane;[4-[3-(methylamino)-2-pyridinyl]piperazin-1-yl]-(1-methylindol-2-yl)methanone.
| Compound Name | ethane;[4-[3-(methylamino)-2-pyridinyl]piperazin-1-yl]-(1-methylindol-2-yl)methanone |
|---|---|
| PubChem CID | 91005889 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | ethane;[4-[3-(methylamino)-2-pyridinyl]piperazin-1-yl]-(1-methylindol-2-yl)methanone |
| SMILES | CC.CC.CNc1cccnc1N1CCN(C(=O)c2cc3ccccc3n2C)CC1 |
| InChI | InChI=1S/C20H23N5O.2C2H6/c1-21-16-7-5-9-22-19(16)24-10-12-25(13-11-24)20(26)18-14-15-6-3-4-8-17(15)23(18)2;2*1-2/h3-9,14,21H,10-13H2,1-2H3;2*1-2H3 |
| InChIKey | LMLKQCHMIYKFFB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |