C24H31FN2O2 — CID 91006329
tert-butyl N-[(2-fluorophenyl)-[1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methyl]carbamate (PubChem CID 91006329) has the molecular formula C24H31FN2O2 and a molecular weight of 398.52 g/mol. Its IUPAC name is tert-butyl N-[(2-fluorophenyl)-[1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[(2-fluorophenyl)-[1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 91006329 |
| Molecular Formula | C24H31FN2O2 |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | tert-butyl N-[(2-fluorophenyl)-[1-[(1S)-1-phenylethyl]pyrrolidin-3-yl]methyl]carbamate |
| SMILES | C[C@@H](c1ccccc1)N1CCC(C(NC(=O)OC(C)(C)C)c2ccccc2F)C1 |
| InChI | InChI=1S/C24H31FN2O2/c1-17(18-10-6-5-7-11-18)27-15-14-19(16-27)22(20-12-8-9-13-21(20)25)26-23(28)29-24(2,3)4/h5-13,17,19,22H,14-16H2,1-4H3,(H,26,28)/t17-,19?,22?/m0/s1 |
| InChIKey | MDCBRMSINWPGIO-QXAHSBQVSA-N |
| XLogP | 5.47 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |