C23H19N7O2 — CID 91007022
N-benzoyl-5-methyl-7-naphthalen-1-yl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carbohydrazide (PubChem CID 91007022) has the molecular formula C23H19N7O2 and a molecular weight of 425.45 g/mol. Its IUPAC name is N-benzoyl-5-methyl-7-naphthalen-1-yl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carbohydrazide.
| Compound Name | N-benzoyl-5-methyl-7-naphthalen-1-yl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carbohydrazide |
|---|---|
| PubChem CID | 91007022 |
| Molecular Formula | C23H19N7O2 |
| Molecular Weight | 425.45 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | N-benzoyl-5-methyl-7-naphthalen-1-yl-6,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carbohydrazide |
| SMILES | CC1=Nc2nnnn2C(c2cccc3ccccc23)C1C(=O)N(N)C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H19N7O2/c1-14-19(22(32)29(24)21(31)16-9-3-2-4-10-16)20(30-23(25-14)26-27-28-30)18-13-7-11-15-8-5-6-12-17(15)18/h2-13,19-20H,24H2,1H3 |
| InChIKey | PNGKQNWSQBQHMT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.45 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|