C9H12N2 — CID 91008141
4-methanimidoyl-2,3-dimethylhexa-2,4-dienenitrile (PubChem CID 91008141) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 4-methanimidoyl-2,3-dimethylhexa-2,4-dienenitrile.
| Compound Name | 4-methanimidoyl-2,3-dimethylhexa-2,4-dienenitrile |
|---|---|
| PubChem CID | 91008141 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 4-methanimidoyl-2,3-dimethylhexa-2,4-dienenitrile |
| SMILES | [H]/N=C/C(=CC)C(C)=C(C)C#N |
| InChI | InChI=1S/C9H12N2/c1-4-9(6-11)8(3)7(2)5-10/h4,6,11H,1-3H3/b8-7?,9-4?,11-6+ |
| InChIKey | ONGRLQONDXFXQB-NULCMSDBSA-N |
| XLogP | 2.44 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|