C14H8N2S3 — CID 91008808
4,7-dithiophen-2-yl-[1,2]thiazolo[4,5-c]pyridine (PubChem CID 91008808) has the molecular formula C14H8N2S3 and a molecular weight of 300.43 g/mol. Its IUPAC name is 4,7-dithiophen-2-yl-[1,2]thiazolo[4,5-c]pyridine.
| Compound Name | 4,7-dithiophen-2-yl-[1,2]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 91008808 |
| Molecular Formula | C14H8N2S3 |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 4,7-dithiophen-2-yl-[1,2]thiazolo[4,5-c]pyridine |
| SMILES | c1csc(-c2ncc(-c3cccs3)c3sncc23)c1 |
| InChI | InChI=1S/C14H8N2S3/c1-3-11(17-5-1)9-7-15-13(12-4-2-6-18-12)10-8-16-19-14(9)10/h1-8H |
| InChIKey | DJJMFRMNWNEIPN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |