C15H14F3NO3S — CID 91010149
[3-(trifluoromethyl)phenyl]methyl 3-(1-methylidene-2-oxo-5H-1,3-thiazol-4-yl)propanoate (PubChem CID 91010149) has the molecular formula C15H14F3NO3S and a molecular weight of 345.34 g/mol. Its IUPAC name is [3-(trifluoromethyl)phenyl]methyl 3-(1-methylidene-2-oxo-5H-1,3-thiazol-4-yl)propanoate.
| Compound Name | [3-(trifluoromethyl)phenyl]methyl 3-(1-methylidene-2-oxo-5H-1,3-thiazol-4-yl)propanoate |
|---|---|
| PubChem CID | 91010149 |
| Molecular Formula | C15H14F3NO3S |
| Molecular Weight | 345.34 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | [3-(trifluoromethyl)phenyl]methyl 3-(1-methylidene-2-oxo-5H-1,3-thiazol-4-yl)propanoate |
| SMILES | C=S1CC(CCC(=O)OCc2cccc(C(F)(F)F)c2)=NC1=O |
| InChI | InChI=1S/C15H14F3NO3S/c1-23-9-12(19-14(23)21)5-6-13(20)22-8-10-3-2-4-11(7-10)15(16,17)18/h2-4,7H,1,5-6,8-9H2 |
| InChIKey | HZPHXTKCUSODEN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|