C16H17F3N2O — CID 91011773
9-[(1S,2R)-2-methylcyclopropyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol (PubChem CID 91011773) has the molecular formula C16H17F3N2O and a molecular weight of 310.32 g/mol. Its IUPAC name is 9-[(1S,2R)-2-methylcyclopropyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol.
| Compound Name | 9-[(1S,2R)-2-methylcyclopropyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
|---|---|
| PubChem CID | 91011773 |
| Molecular Formula | C16H17F3N2O |
| Molecular Weight | 310.32 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 9-[(1S,2R)-2-methylcyclopropyl]-7-(trifluoromethyl)-1,2,3,4-tetrahydropyrazino[1,2-b]isoindol-6-ol |
| SMILES | C[C@@H]1C[C@@H]1c1cc(C(F)(F)F)c2c(O)n3c(c2c1)CNCC3 |
| InChI | InChI=1S/C16H17F3N2O/c1-8-4-10(8)9-5-11-13-7-20-2-3-21(13)15(22)14(11)12(6-9)16(17,18)19/h5-6,8,10,20,22H,2-4,7H2,1H3/t8-,10+/m1/s1 |
| InChIKey | RDRCMKDMUOQONC-SCZZXKLOSA-N |
| XLogP | 3.59 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |