C19H33NO2 — CID 91012210
1-hept-2-enyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one (PubChem CID 91012210) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 1-hept-2-enyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one.
| Compound Name | 1-hept-2-enyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 91012210 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 1-hept-2-enyl-5-[(E)-3-hydroxyoct-1-enyl]pyrrolidin-2-one |
| SMILES | CCCCC=CCN1C(=O)CCC1/C=C/C(O)CCCCC |
| InChI | InChI=1S/C19H33NO2/c1-3-5-7-8-10-16-20-17(13-15-19(20)22)12-14-18(21)11-9-6-4-2/h8,10,12,14,17-18,21H,3-7,9,11,13,15-16H2,1-2H3/b10-8?,14-12+ |
| InChIKey | BKGHJZNSIIEUDB-ZMIWSCJLSA-N |
| XLogP | 4.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|