C25H26N2O4 — CID 91012413
(4R,5S)-3-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)-4-(4-phenylmethoxyphenyl)-1,3-oxazolidin-2-one (PubChem CID 91012413) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is (4R,5S)-3-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)-4-(4-phenylmethoxyphenyl)-1,3-oxazolidin-2-one.
| Compound Name | (4R,5S)-3-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)-4-(4-phenylmethoxyphenyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 91012413 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (4R,5S)-3-[4-(dimethylamino)phenyl]-5-(hydroxymethyl)-4-(4-phenylmethoxyphenyl)-1,3-oxazolidin-2-one |
| SMILES | CN(C)c1ccc(N2C(=O)O[C@H](CO)[C@H]2c2ccc(OCc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c1-26(2)20-10-12-21(13-11-20)27-24(23(16-28)31-25(27)29)19-8-14-22(15-9-19)30-17-18-6-4-3-5-7-18/h3-15,23-24,28H,16-17H2,1-2H3/t23-,24-/m1/s1 |
| InChIKey | UKJVPAPSFAFDLE-DNQXCXABSA-N |
| XLogP | 4.39 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|