C28H23N4O+ — CID 91014002
3-[[2-[4-(3,4-dimethylphenyl)phenyl]-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,2-benzoxazole (PubChem CID 91014002) has the molecular formula C28H23N4O+ and a molecular weight of 431.52 g/mol. Its IUPAC name is 3-[[2-[4-(3,4-dimethylphenyl)phenyl]-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,2-benzoxazole.
| Compound Name | 3-[[2-[4-(3,4-dimethylphenyl)phenyl]-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,2-benzoxazole |
|---|---|
| PubChem CID | 91014002 |
| Molecular Formula | C28H23N4O+ |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 3-[[2-[4-(3,4-dimethylphenyl)phenyl]-3H-imidazo[4,5-c]pyridin-5-ium-5-yl]methyl]-1,2-benzoxazole |
| SMILES | Cc1ccc(-c2ccc(-c3nc4cc[n+](Cc5noc6ccccc56)cc4[nH]3)cc2)cc1C |
| InChI | InChI=1S/C28H22N4O/c1-18-7-8-22(15-19(18)2)20-9-11-21(12-10-20)28-29-24-13-14-32(17-26(24)30-28)16-25-23-5-3-4-6-27(23)33-31-25/h3-15,17H,16H2,1-2H3/p+1 |
| InChIKey | YFKMRUQJUJIZEN-UHFFFAOYSA-O |
| XLogP | 5.99 |
| TPSA | 58.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|