C26H39N3O2 — CID 91014030
3-[4-[4-(dimethylcarbamoyl)phenyl]-1-methylpiperidin-4-yl]benzamide;ethane (PubChem CID 91014030) has the molecular formula C26H39N3O2 and a molecular weight of 425.62 g/mol. Its IUPAC name is 3-[4-[4-(dimethylcarbamoyl)phenyl]-1-methylpiperidin-4-yl]benzamide;ethane.
| Compound Name | 3-[4-[4-(dimethylcarbamoyl)phenyl]-1-methylpiperidin-4-yl]benzamide;ethane |
|---|---|
| PubChem CID | 91014030 |
| Molecular Formula | C26H39N3O2 |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 3-[4-[4-(dimethylcarbamoyl)phenyl]-1-methylpiperidin-4-yl]benzamide;ethane |
| SMILES | CC.CC.CN1CCC(c2ccc(C(=O)N(C)C)cc2)(c2cccc(C(N)=O)c2)CC1 |
| InChI | InChI=1S/C22H27N3O2.2C2H6/c1-24(2)21(27)16-7-9-18(10-8-16)22(11-13-25(3)14-12-22)19-6-4-5-17(15-19)20(23)26;2*1-2/h4-10,15H,11-14H2,1-3H3,(H2,23,26);2*1-2H3 |
| InChIKey | UZGNHKYTWIVCPP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |