C27H18F2N3S+ — CID 91014204
5-[[4-(1-benzothiophen-3-yl)phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium (PubChem CID 91014204) has the molecular formula C27H18F2N3S+ and a molecular weight of 454.53 g/mol. Its IUPAC name is 5-[[4-(1-benzothiophen-3-yl)phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium.
| Compound Name | 5-[[4-(1-benzothiophen-3-yl)phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium |
|---|---|
| PubChem CID | 91014204 |
| Molecular Formula | C27H18F2N3S+ |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 5-[[4-(1-benzothiophen-3-yl)phenyl]methyl]-2-(2,3-difluorophenyl)-3H-imidazo[4,5-c]pyridin-5-ium |
| SMILES | Fc1cccc(-c2nc3cc[n+](Cc4ccc(-c5csc6ccccc56)cc4)cc3[nH]2)c1F |
| InChI | InChI=1S/C27H17F2N3S/c28-22-6-3-5-20(26(22)29)27-30-23-12-13-32(15-24(23)31-27)14-17-8-10-18(11-9-17)21-16-33-25-7-2-1-4-19(21)25/h1-13,15-16H,14H2/p+1 |
| InChIKey | MOFWYBZNAJLGJM-UHFFFAOYSA-O |
| XLogP | 6.73 |
| TPSA | 32.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|