C17H18ClNO7S2 — CID 91014266
[1-[3-[(3-chloro-2-methylphenyl)sulfonylamino]thiophen-2-yl]peroxy-1-oxobutan-2-yl] acetate (PubChem CID 91014266) has the molecular formula C17H18ClNO7S2 and a molecular weight of 447.92 g/mol. Its IUPAC name is [1-[3-[(3-chloro-2-methylphenyl)sulfonylamino]thiophen-2-yl]peroxy-1-oxobutan-2-yl] acetate.
| Compound Name | [1-[3-[(3-chloro-2-methylphenyl)sulfonylamino]thiophen-2-yl]peroxy-1-oxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 91014266 |
| Molecular Formula | C17H18ClNO7S2 |
| Molecular Weight | 447.92 g/mol |
| Exact Mass | 447.02 |
| IUPAC Name | [1-[3-[(3-chloro-2-methylphenyl)sulfonylamino]thiophen-2-yl]peroxy-1-oxobutan-2-yl] acetate |
| SMILES | CCC(OC(C)=O)C(=O)OOc1sccc1NS(=O)(=O)c1cccc(Cl)c1C |
| InChI | InChI=1S/C17H18ClNO7S2/c1-4-14(24-11(3)20)16(21)25-26-17-13(8-9-27-17)19-28(22,23)15-7-5-6-12(18)10(15)2/h5-9,14,19H,4H2,1-3H3 |
| InChIKey | GYXLJDCQSJJFGQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.92 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|