C10H12N2OS — CID 91015818
N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-methylprop-2-enamide (PubChem CID 91015818) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-methylprop-2-enamide.
| Compound Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 91015818 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N-(4-cyclopropyl-1,3-thiazol-2-yl)-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)Nc1nc(C2CC2)cs1 |
| InChI | InChI=1S/C10H12N2OS/c1-6(2)9(13)12-10-11-8(5-14-10)7-3-4-7/h5,7H,1,3-4H2,2H3,(H,11,12,13) |
| InChIKey | AHLVQYKJLBNTBO-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|