C12H11N3O4 — CID 91016540
methyl 5-methoxy-4-oxo-6-pyridin-4-yl-1H-pyridazine-3-carboxylate (PubChem CID 91016540) has the molecular formula C12H11N3O4 and a molecular weight of 261.24 g/mol. Its IUPAC name is methyl 5-methoxy-4-oxo-6-pyridin-4-yl-1H-pyridazine-3-carboxylate.
| Compound Name | methyl 5-methoxy-4-oxo-6-pyridin-4-yl-1H-pyridazine-3-carboxylate |
|---|---|
| PubChem CID | 91016540 |
| Molecular Formula | C12H11N3O4 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | methyl 5-methoxy-4-oxo-6-pyridin-4-yl-1H-pyridazine-3-carboxylate |
| SMILES | COC(=O)c1n[nH]c(-c2ccncc2)c(OC)c1=O |
| InChI | InChI=1S/C12H11N3O4/c1-18-11-8(7-3-5-13-6-4-7)14-15-9(10(11)16)12(17)19-2/h3-6H,1-2H3,(H,14,16) |
| InChIKey | GRMARVAMNJCEBM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |