C31H29ClN4O3 — CID 91017304
(4-methylphenyl) 6-chloro-1-[3-(3-imidazol-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate (PubChem CID 91017304) has the molecular formula C31H29ClN4O3 and a molecular weight of 541.05 g/mol. Its IUPAC name is (4-methylphenyl) 6-chloro-1-[3-(3-imidazol-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate.
| Compound Name | (4-methylphenyl) 6-chloro-1-[3-(3-imidazol-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
|---|---|
| PubChem CID | 91017304 |
| Molecular Formula | C31H29ClN4O3 |
| Molecular Weight | 541.05 g/mol |
| Exact Mass | 540.19 |
| IUPAC Name | (4-methylphenyl) 6-chloro-1-[3-(3-imidazol-1-ylpropoxy)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carboxylate |
| SMILES | Cc1ccc(OC(=O)N2CCc3c([nH]c4ccc(Cl)cc34)C2c2cccc(OCCCn3ccnc3)c2)cc1 |
| InChI | InChI=1S/C31H29ClN4O3/c1-21-6-9-24(10-7-21)39-31(37)36-15-12-26-27-19-23(32)8-11-28(27)34-29(26)30(36)22-4-2-5-25(18-22)38-17-3-14-35-16-13-33-20-35/h2,4-11,13,16,18-20,30,34H,3,12,14-15,17H2,1H3 |
| InChIKey | JYYOMWACVXRZJF-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 72.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.05 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|