C28H39N3 — CID 91018036
(3S)-1-benzyl-N-methyl-N-[[3-(2-methyl-4-pyrrolidin-1-ylphenyl)cyclobutyl]methyl]pyrrolidin-3-amine (PubChem CID 91018036) has the molecular formula C28H39N3 and a molecular weight of 417.64 g/mol. Its IUPAC name is (3S)-1-benzyl-N-methyl-N-[[3-(2-methyl-4-pyrrolidin-1-ylphenyl)cyclobutyl]methyl]pyrrolidin-3-amine.
| Compound Name | (3S)-1-benzyl-N-methyl-N-[[3-(2-methyl-4-pyrrolidin-1-ylphenyl)cyclobutyl]methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 91018036 |
| Molecular Formula | C28H39N3 |
| Molecular Weight | 417.64 g/mol |
| Exact Mass | 417.31 |
| IUPAC Name | (3S)-1-benzyl-N-methyl-N-[[3-(2-methyl-4-pyrrolidin-1-ylphenyl)cyclobutyl]methyl]pyrrolidin-3-amine |
| SMILES | Cc1cc(N2CCCC2)ccc1C1CC(CN(C)[C@H]2CCN(Cc3ccccc3)C2)C1 |
| InChI | InChI=1S/C28H39N3/c1-22-16-26(31-13-6-7-14-31)10-11-28(22)25-17-24(18-25)19-29(2)27-12-15-30(21-27)20-23-8-4-3-5-9-23/h3-5,8-11,16,24-25,27H,6-7,12-15,17-21H2,1-2H3/t24?,25?,27-/m0/s1 |
| InChIKey | IWOHBLAWBGHFIJ-ONJSCSTBSA-N |
| XLogP | 5.30 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.64 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|