C27H34O7 — CID 91018724
2-[(8R,9R,10R,13S,14S)-16-(2-acetyloxyethynyl)-4,17-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate (PubChem CID 91018724) has the molecular formula C27H34O7 and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-[(8R,9R,10R,13S,14S)-16-(2-acetyloxyethynyl)-4,17-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate.
| Compound Name | 2-[(8R,9R,10R,13S,14S)-16-(2-acetyloxyethynyl)-4,17-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate |
|---|---|
| PubChem CID | 91018724 |
| Molecular Formula | C27H34O7 |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 2-[(8R,9R,10R,13S,14S)-16-(2-acetyloxyethynyl)-4,17-dihydroxy-13-(hydroxymethyl)-10-methyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]ethynyl acetate |
| SMILES | CC(=O)OC#CC1CC[C@@]2(C)C(=CC[C@@H]3[C@H]2CC[C@]2(CO)C(O)C(C#COC(C)=O)C[C@@H]32)C1O |
| InChI | InChI=1S/C27H34O7/c1-16(29)33-12-8-18-6-10-26(3)21-7-11-27(15-28)23(20(21)4-5-22(26)24(18)31)14-19(25(27)32)9-13-34-17(2)30/h5,18-21,23-25,28,31-32H,4,6-7,10-11,14-15H2,1-3H3/t18?,19?,20-,21-,23+,24?,25?,26-,27-/m1/s1 |
| InChIKey | SHKPJMSOLZTCHP-TUFBNPRISA-N |
| XLogP | 2.14 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|