C23H23ClN2O7 — CID 91018728
3-[3-[2-[[2-(3-chloro-2,4,5,6-tetrahydroxyphenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]benzoic acid (PubChem CID 91018728) has the molecular formula C23H23ClN2O7 and a molecular weight of 474.90 g/mol. Its IUPAC name is 3-[3-[2-[[2-(3-chloro-2,4,5,6-tetrahydroxyphenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]benzoic acid.
| Compound Name | 3-[3-[2-[[2-(3-chloro-2,4,5,6-tetrahydroxyphenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]benzoic acid |
|---|---|
| PubChem CID | 91018728 |
| Molecular Formula | C23H23ClN2O7 |
| Molecular Weight | 474.90 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-[3-[2-[[2-(3-chloro-2,4,5,6-tetrahydroxyphenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cccc(NCCNCC(O)c3c(O)c(O)c(O)c(Cl)c3O)c2)c1 |
| InChI | InChI=1S/C23H23ClN2O7/c24-18-19(28)17(20(29)22(31)21(18)30)16(27)11-25-7-8-26-15-6-2-4-13(10-15)12-3-1-5-14(9-12)23(32)33/h1-6,9-10,16,25-31H,7-8,11H2,(H,32,33) |
| InChIKey | ZPNKHRQCIGRAML-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 162.51 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.90 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|