C18H21ClN2O4 — CID 67720842
2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]-2-hydroxyacetic acid (PubChem CID 67720842) has the molecular formula C18H21ClN2O4 and a molecular weight of 364.83 g/mol. Its IUPAC name is 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]-2-hydroxyacetic acid.
| Compound Name | 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 67720842 |
| Molecular Formula | C18H21ClN2O4 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-[4-[2-[[2-(3-chlorophenyl)-2-hydroxyethyl]amino]ethylamino]phenyl]-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(NCCNCC(O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H21ClN2O4/c19-14-3-1-2-13(10-14)16(22)11-20-8-9-21-15-6-4-12(5-7-15)17(23)18(24)25/h1-7,10,16-17,20-23H,8-9,11H2,(H,24,25) |
| InChIKey | FMFCPKFNMFNURH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 101.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|