C14H26B3N2O2 — CID 91020729
CID 91020729 (PubChem CID 91020729) has the molecular formula C14H26B3N2O2 and a molecular weight of 286.81 g/mol.
| Compound Name | CID 91020729 |
|---|---|
| PubChem CID | 91020729 |
| Molecular Formula | C14H26B3N2O2 |
| Molecular Weight | 286.81 g/mol |
| Exact Mass | 287.23 |
| IUPAC Name | — |
| SMILES | CC1CCN([C@H](C(=O)O)C2CCN(C)CC2)CC1.[B][B][B] |
| InChI | InChI=1S/C14H26N2O2.B3/c1-11-3-9-16(10-4-11)13(14(17)18)12-5-7-15(2)8-6-12;1-3-2/h11-13H,3-10H2,1-2H3,(H,17,18);/t13-;/m0./s1 |
| InChIKey | QFYKNPYULGGDKT-ZOWNYOTGSA-N |
| XLogP | 0.37 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.81 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|