C14H26N4O4S — CID 136558071
2-cyclopropyl-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid (PubChem CID 136558071) has the molecular formula C14H26N4O4S and a molecular weight of 346.45 g/mol. Its IUPAC name is 2-cyclopropyl-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid.
| Compound Name | 2-cyclopropyl-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid |
|---|---|
| PubChem CID | 136558071 |
| Molecular Formula | C14H26N4O4S |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-cyclopropyl-2-[4-(4-methylpiperazin-1-yl)sulfonylpiperazin-1-yl]acetic acid |
| SMILES | CN1CCN(S(=O)(=O)N2CCN(C(C(=O)O)C3CC3)CC2)CC1 |
| InChI | InChI=1S/C14H26N4O4S/c1-15-4-8-17(9-5-15)23(21,22)18-10-6-16(7-11-18)13(14(19)20)12-2-3-12/h12-13H,2-11H2,1H3,(H,19,20) |
| InChIKey | QUQCSUFZRUKSKZ-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |