C14H29N5O4S2 — CID 97260419
1-methyl-4-[4-[(3S)-3-methylpyrrolidin-1-yl]sulfonylpiperazin-1-yl]sulfonylpiperazine (PubChem CID 97260419) has the molecular formula C14H29N5O4S2 and a molecular weight of 395.55 g/mol. Its IUPAC name is 1-methyl-4-[4-[(3S)-3-methylpyrrolidin-1-yl]sulfonylpiperazin-1-yl]sulfonylpiperazine.
| Compound Name | 1-methyl-4-[4-[(3S)-3-methylpyrrolidin-1-yl]sulfonylpiperazin-1-yl]sulfonylpiperazine |
|---|---|
| PubChem CID | 97260419 |
| Molecular Formula | C14H29N5O4S2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | 1-methyl-4-[4-[(3S)-3-methylpyrrolidin-1-yl]sulfonylpiperazin-1-yl]sulfonylpiperazine |
| SMILES | C[C@H]1CCN(S(=O)(=O)N2CCN(S(=O)(=O)N3CCN(C)CC3)CC2)C1 |
| InChI | InChI=1S/C14H29N5O4S2/c1-14-3-4-19(13-14)25(22,23)18-11-9-17(10-12-18)24(20,21)16-7-5-15(2)6-8-16/h14H,3-13H2,1-2H3/t14-/m0/s1 |
| InChIKey | KCGJLOZVHXDNKM-AWEZNQCLSA-N |
| XLogP | -1.32 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |