C18H26BrN3O4 — CID 91021623
tert-butyl (2R)-4-(2-bromo-6-methoxycarbonyl-3-pyridinyl)-2-ethylpiperazine-1-carboxylate (PubChem CID 91021623) has the molecular formula C18H26BrN3O4 and a molecular weight of 428.33 g/mol. Its IUPAC name is tert-butyl (2R)-4-(2-bromo-6-methoxycarbonyl-3-pyridinyl)-2-ethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl (2R)-4-(2-bromo-6-methoxycarbonyl-3-pyridinyl)-2-ethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 91021623 |
| Molecular Formula | C18H26BrN3O4 |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | tert-butyl (2R)-4-(2-bromo-6-methoxycarbonyl-3-pyridinyl)-2-ethylpiperazine-1-carboxylate |
| SMILES | CC[C@@H]1CN(c2ccc(C(=O)OC)nc2Br)CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H26BrN3O4/c1-6-12-11-21(9-10-22(12)17(24)26-18(2,3)4)14-8-7-13(16(23)25-5)20-15(14)19/h7-8,12H,6,9-11H2,1-5H3/t12-/m1/s1 |
| InChIKey | QBKNIQQQTOJBRC-GFCCVEGCSA-N |
| XLogP | 3.47 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|