C23H21F4N3O6 — CID 91021792
N-[2-[1-[3,4-bis(difluoromethoxy)phenyl]-3-(hydroxyamino)-3-oxopropyl]-3-hydroxyisoindol-4-yl]cyclopropanecarboxamide (PubChem CID 91021792) has the molecular formula C23H21F4N3O6 and a molecular weight of 511.43 g/mol. Its IUPAC name is N-[2-[1-[3,4-bis(difluoromethoxy)phenyl]-3-(hydroxyamino)-3-oxopropyl]-3-hydroxyisoindol-4-yl]cyclopropanecarboxamide.
| Compound Name | N-[2-[1-[3,4-bis(difluoromethoxy)phenyl]-3-(hydroxyamino)-3-oxopropyl]-3-hydroxyisoindol-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 91021792 |
| Molecular Formula | C23H21F4N3O6 |
| Molecular Weight | 511.43 g/mol |
| Exact Mass | 511.14 |
| IUPAC Name | N-[2-[1-[3,4-bis(difluoromethoxy)phenyl]-3-(hydroxyamino)-3-oxopropyl]-3-hydroxyisoindol-4-yl]cyclopropanecarboxamide |
| SMILES | O=C(CC(c1ccc(OC(F)F)c(OC(F)F)c1)n1cc2cccc(NC(=O)C3CC3)c2c1O)NO |
| InChI | InChI=1S/C23H21F4N3O6/c24-22(25)35-16-7-6-12(8-17(16)36-23(26)27)15(9-18(31)29-34)30-10-13-2-1-3-14(19(13)21(30)33)28-20(32)11-4-5-11/h1-3,6-8,10-11,15,22-23,33-34H,4-5,9H2,(H,28,32)(H,29,31) |
| InChIKey | AXANDGRYOGNKIN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 122.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|