C17H22N3O3+ — CID 9102283
[(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl]-methyl-[(5-methylfuran-2-yl)methyl]azanium (PubChem CID 9102283) has the molecular formula C17H22N3O3+ and a molecular weight of 316.38 g/mol. Its IUPAC name is [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl]-methyl-[(5-methylfuran-2-yl)methyl]azanium.
| Compound Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl]-methyl-[(5-methylfuran-2-yl)methyl]azanium |
|---|---|
| PubChem CID | 9102283 |
| Molecular Formula | C17H22N3O3+ |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl]-methyl-[(5-methylfuran-2-yl)methyl]azanium |
| SMILES | Cc1ccc(C[NH+](C)[C@H](C)C(=O)Nc2ccc(C(N)=O)cc2)o1 |
| InChI | InChI=1S/C17H21N3O3/c1-11-4-9-15(23-11)10-20(3)12(2)17(22)19-14-7-5-13(6-8-14)16(18)21/h4-9,12H,10H2,1-3H3,(H2,18,21)(H,19,22)/p+1/t12-/m1/s1 |
| InChIKey | OURXSESTZLAVRO-GFCCVEGCSA-O |
| XLogP | 0.73 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |