C15H19N2O2+ — CID 9332217
[(2S)-1-anilino-1-oxopropan-2-yl]-(furan-2-ylmethyl)-methylazanium (PubChem CID 9332217) has the molecular formula C15H19N2O2+ and a molecular weight of 259.33 g/mol. Its IUPAC name is [(2S)-1-anilino-1-oxopropan-2-yl]-(furan-2-ylmethyl)-methylazanium.
| Compound Name | [(2S)-1-anilino-1-oxopropan-2-yl]-(furan-2-ylmethyl)-methylazanium |
|---|---|
| PubChem CID | 9332217 |
| Molecular Formula | C15H19N2O2+ |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | [(2S)-1-anilino-1-oxopropan-2-yl]-(furan-2-ylmethyl)-methylazanium |
| SMILES | C[C@@H](C(=O)Nc1ccccc1)[NH+](C)Cc1ccco1 |
| InChI | InChI=1S/C15H18N2O2/c1-12(17(2)11-14-9-6-10-19-14)15(18)16-13-7-4-3-5-8-13/h3-10,12H,11H2,1-2H3,(H,16,18)/p+1/t12-/m0/s1 |
| InChIKey | MRBGBHIJNQNHRU-LBPRGKRZSA-O |
| XLogP | 1.32 |
| TPSA | 46.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |