C17H31NO5 — CID 91024442
hexyl (2R,3R,4S)-3-hydroxy-4-[(1S)-1-hydroxy-2-methylpropyl]-1,3-dimethyl-5-oxopyrrolidine-2-carboxylate (PubChem CID 91024442) has the molecular formula C17H31NO5 and a molecular weight of 329.44 g/mol. Its IUPAC name is hexyl (2R,3R,4S)-3-hydroxy-4-[(1S)-1-hydroxy-2-methylpropyl]-1,3-dimethyl-5-oxopyrrolidine-2-carboxylate.
| Compound Name | hexyl (2R,3R,4S)-3-hydroxy-4-[(1S)-1-hydroxy-2-methylpropyl]-1,3-dimethyl-5-oxopyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 91024442 |
| Molecular Formula | C17H31NO5 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.22 |
| IUPAC Name | hexyl (2R,3R,4S)-3-hydroxy-4-[(1S)-1-hydroxy-2-methylpropyl]-1,3-dimethyl-5-oxopyrrolidine-2-carboxylate |
| SMILES | CCCCCCOC(=O)[C@@H]1N(C)C(=O)[C@@H]([C@@H](O)C(C)C)[C@@]1(C)O |
| InChI | InChI=1S/C17H31NO5/c1-6-7-8-9-10-23-16(21)14-17(4,22)12(13(19)11(2)3)15(20)18(14)5/h11-14,19,22H,6-10H2,1-5H3/t12-,13+,14+,17-/m1/s1 |
| InChIKey | RDPPJIBWTNMLBA-XJIUQZFPSA-N |
| XLogP | 1.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|