C16H19BrN2O2 — CID 9102591
N-(3-bromo-4-methylphenyl)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]acetamide (PubChem CID 9102591) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is N-(3-bromo-4-methylphenyl)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]acetamide.
| Compound Name | N-(3-bromo-4-methylphenyl)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]acetamide |
|---|---|
| PubChem CID | 9102591 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | N-(3-bromo-4-methylphenyl)-2-[methyl-[(5-methylfuran-2-yl)methyl]amino]acetamide |
| SMILES | Cc1ccc(CN(C)CC(=O)Nc2ccc(C)c(Br)c2)o1 |
| InChI | InChI=1S/C16H19BrN2O2/c1-11-4-6-13(8-15(11)17)18-16(20)10-19(3)9-14-7-5-12(2)21-14/h4-8H,9-10H2,1-3H3,(H,18,20) |
| InChIKey | ZUUVFOAUDQEZNJ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |