C32H36FN7O — CID 91027092
8-[(1R)-1,2-dihydroacenaphthylen-1-yl]-3-[2-[5-[(dimethylamino)methyl]-1H-1,2,4-triazol-3-yl]ethyl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 91027092) has the molecular formula C32H36FN7O and a molecular weight of 553.69 g/mol. Its IUPAC name is 8-[(1R)-1,2-dihydroacenaphthylen-1-yl]-3-[2-[5-[(dimethylamino)methyl]-1H-1,2,4-triazol-3-yl]ethyl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 8-[(1R)-1,2-dihydroacenaphthylen-1-yl]-3-[2-[5-[(dimethylamino)methyl]-1H-1,2,4-triazol-3-yl]ethyl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 91027092 |
| Molecular Formula | C32H36FN7O |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.30 |
| IUPAC Name | 8-[(1R)-1,2-dihydroacenaphthylen-1-yl]-3-[2-[5-[(dimethylamino)methyl]-1H-1,2,4-triazol-3-yl]ethyl]-1-(4-fluorophenyl)-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CN(C)Cc1nc(CCN2CN(c3ccc(F)cc3)C3(CCN([C@@H]4Cc5cccc6cccc4c56)CC3)C2=O)n[nH]1 |
| InChI | InChI=1S/C32H36FN7O/c1-37(2)20-29-34-28(35-36-29)13-16-39-21-40(25-11-9-24(33)10-12-25)32(31(39)41)14-17-38(18-15-32)27-19-23-7-3-5-22-6-4-8-26(27)30(22)23/h3-12,27H,13-21H2,1-2H3,(H,34,35,36)/t27-/m1/s1 |
| InChIKey | KYZLAQNVFJPDCJ-HHHXNRCGSA-N |
| XLogP | 4.14 |
| TPSA | 71.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |