C12H13NO2 — CID 91029295
4-methyl-4-azatetracyclo[5.4.1.01,10.02,6]dodeca-2,5,8-triene-3,5-diol (PubChem CID 91029295) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is 4-methyl-4-azatetracyclo[5.4.1.01,10.02,6]dodeca-2,5,8-triene-3,5-diol.
| Compound Name | 4-methyl-4-azatetracyclo[5.4.1.01,10.02,6]dodeca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 91029295 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 4-methyl-4-azatetracyclo[5.4.1.01,10.02,6]dodeca-2,5,8-triene-3,5-diol |
| SMILES | Cn1c(O)c2c(c1O)C13CC2C=CC1C3 |
| InChI | InChI=1S/C12H13NO2/c1-13-10(14)8-6-2-3-7-5-12(7,4-6)9(8)11(13)15/h2-3,6-7,14-15H,4-5H2,1H3 |
| InChIKey | SFYONNRSNNEJBK-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|