C29H50N2O6 — CID 91029431
5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(3R)-oxolan-3-yl]-2-propan-2-ylnonanamide (PubChem CID 91029431) has the molecular formula C29H50N2O6 and a molecular weight of 522.73 g/mol. Its IUPAC name is 5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(3R)-oxolan-3-yl]-2-propan-2-ylnonanamide.
| Compound Name | 5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(3R)-oxolan-3-yl]-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 91029431 |
| Molecular Formula | C29H50N2O6 |
| Molecular Weight | 522.73 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | 5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(3R)-oxolan-3-yl]-2-propan-2-ylnonanamide |
| SMILES | COCCCOc1cc(CC(CC(N)C(O)CC(C(=O)N[C@@H]2CCOC2)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C29H50N2O6/c1-19(2)22(14-21-8-9-27(35-6)28(15-21)37-12-7-11-34-5)16-25(30)26(32)17-24(20(3)4)29(33)31-23-10-13-36-18-23/h8-9,15,19-20,22-26,32H,7,10-14,16-18,30H2,1-6H3,(H,31,33)/t22?,23-,24?,25?,26?/m1/s1 |
| InChIKey | YNEZURWYWJIGQJ-IFESPJMPSA-N |
| XLogP | 3.57 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.73 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|