C30H50N2O6 — CID 24992152
(2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-2-propan-2-ylnonanamide (PubChem CID 24992152) has the molecular formula C30H50N2O6 and a molecular weight of 534.74 g/mol. Its IUPAC name is (2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-2-propan-2-ylnonanamide.
| Compound Name | (2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-2-propan-2-ylnonanamide |
|---|---|
| PubChem CID | 24992152 |
| Molecular Formula | C30H50N2O6 |
| Molecular Weight | 534.74 g/mol |
| Exact Mass | 534.37 |
| IUPAC Name | (2S,4S,5S,7S)-5-amino-4-hydroxy-7-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-8-methyl-N-[(1R,5S)-3-oxabicyclo[3.1.0]hexan-6-yl]-2-propan-2-ylnonanamide |
| SMILES | COCCCOc1cc(C[C@@H](C[C@H](N)[C@@H](O)C[C@H](C(=O)NC2[C@H]3COC[C@@H]23)C(C)C)C(C)C)ccc1OC |
| InChI | InChI=1S/C30H50N2O6/c1-18(2)21(12-20-8-9-27(36-6)28(13-20)38-11-7-10-35-5)14-25(31)26(33)15-22(19(3)4)30(34)32-29-23-16-37-17-24(23)29/h8-9,13,18-19,21-26,29,33H,7,10-12,14-17,31H2,1-6H3,(H,32,34)/t21-,22-,23-,24+,25-,26-,29?/m0/s1 |
| InChIKey | MCWRFBDDEIFZMQ-PXILYKQZSA-N |
| XLogP | 3.43 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.74 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|