C13H21F2NO — CID 91029455
2-but-3-en-2-yl-5-(2,2-difluorobutoxy)-1,2,3,6-tetrahydropyridine (PubChem CID 91029455) has the molecular formula C13H21F2NO and a molecular weight of 245.31 g/mol. Its IUPAC name is 2-but-3-en-2-yl-5-(2,2-difluorobutoxy)-1,2,3,6-tetrahydropyridine.
| Compound Name | 2-but-3-en-2-yl-5-(2,2-difluorobutoxy)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 91029455 |
| Molecular Formula | C13H21F2NO |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | 2-but-3-en-2-yl-5-(2,2-difluorobutoxy)-1,2,3,6-tetrahydropyridine |
| SMILES | C=CC(C)C1CC=C(OCC(F)(F)CC)CN1 |
| InChI | InChI=1S/C13H21F2NO/c1-4-10(3)12-7-6-11(8-16-12)17-9-13(14,15)5-2/h4,6,10,12,16H,1,5,7-9H2,2-3H3 |
| InChIKey | KOYBNOAFFIDJRS-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|