C11H18FNO — CID 90736308
5-(fluoromethoxy)-2-(3-methylbut-3-en-2-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 90736308) has the molecular formula C11H18FNO and a molecular weight of 199.27 g/mol. Its IUPAC name is 5-(fluoromethoxy)-2-(3-methylbut-3-en-2-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 5-(fluoromethoxy)-2-(3-methylbut-3-en-2-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 90736308 |
| Molecular Formula | C11H18FNO |
| Molecular Weight | 199.27 g/mol |
| Exact Mass | 199.14 |
| IUPAC Name | 5-(fluoromethoxy)-2-(3-methylbut-3-en-2-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C=C(C)C(C)C1CC=C(OCF)CN1 |
| InChI | InChI=1S/C11H18FNO/c1-8(2)9(3)11-5-4-10(6-13-11)14-7-12/h4,9,11,13H,1,5-7H2,2-3H3 |
| InChIKey | QFGBYJDAGMDHJF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|