C15H24O2S — CID 91030469
4-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycyclohexa-1,3-diene-1-carbothialdehyde (PubChem CID 91030469) has the molecular formula C15H24O2S and a molecular weight of 268.42 g/mol. Its IUPAC name is 4-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycyclohexa-1,3-diene-1-carbothialdehyde.
| Compound Name | 4-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycyclohexa-1,3-diene-1-carbothialdehyde |
|---|---|
| PubChem CID | 91030469 |
| Molecular Formula | C15H24O2S |
| Molecular Weight | 268.42 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 4-[2-methyl-1-[(2-methylpropan-2-yl)oxy]propan-2-yl]oxycyclohexa-1,3-diene-1-carbothialdehyde |
| SMILES | CC(C)(C)OCC(C)(C)OC1=CC=C(C=S)CC1 |
| InChI | InChI=1S/C15H24O2S/c1-14(2,3)16-11-15(4,5)17-13-8-6-12(10-18)7-9-13/h6,8,10H,7,9,11H2,1-5H3 |
| InChIKey | DSQLFZUWMYBRKI-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|