C10H9N3 — CID 91031732
5-imino-6-methylcyclohepta-1,3-diene-1,2-dicarbonitrile (PubChem CID 91031732) has the molecular formula C10H9N3 and a molecular weight of 171.20 g/mol. Its IUPAC name is 5-imino-6-methylcyclohepta-1,3-diene-1,2-dicarbonitrile.
| Compound Name | 5-imino-6-methylcyclohepta-1,3-diene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 91031732 |
| Molecular Formula | C10H9N3 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.08 |
| IUPAC Name | 5-imino-6-methylcyclohepta-1,3-diene-1,2-dicarbonitrile |
| SMILES | [H]/N=C1\C=CC(C#N)=C(C#N)CC1C |
| InChI | InChI=1S/C10H9N3/c1-7-4-9(6-12)8(5-11)2-3-10(7)13/h2-3,7,13H,4H2,1H3/b13-10+ |
| InChIKey | BQVJHEUYSKHWLN-JLHYYAGUSA-N |
| XLogP | 1.95 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|