About 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile
4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile (PubChem CID 123406796) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile |
| PubChem CID | 123406796 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile |
| SMILES | [H]/N=C1\C=CC(C#N)=CCC1C1CC1 |
| InChI | InChI=1S/C11H12N2/c12-7-8-1-5-10(9-3-4-9)11(13)6-2-8/h1-2,6,9-10,13H,3-5H2/b13-11+ |
| InChIKey | MZEHOZAFJADJID-ACCUITESSA-N |
| XLogP | 2.44 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile?
The IUPAC name of 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile (CID 123406796) is 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile.
What is the SMILES notation for 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile?
The canonical SMILES for 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile is [H]/N=C1\C=CC(C#N)=CCC1C1CC1.
What is the InChIKey of 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile?
The InChIKey is MZEHOZAFJADJID-ACCUITESSA-N. The full InChI is InChI=1S/C11H12N2/c12-7-8-1-5-10(9-3-4-9)11(13)6-2-8/h1-2,6,9-10,13H,3-5H2/b13-11+.
What are the key properties of 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile?
4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile has a molecular weight of 172.23 g/mol, XLogP of 2.44, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclopropyl-5-iminocyclohepta-1,6-diene-1-carbonitrile is sourced from PubChem (CID 123406796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).