C11H14N+ — CID 91246055
1-(6-methyl-4-bicyclo[5.1.0]octa-2,4-dienyl)ethanimine (PubChem CID 91246055) has the molecular formula C11H14N+ and a molecular weight of 160.24 g/mol. Its IUPAC name is 1-(6-methyl-4-bicyclo[5.1.0]octa-2,4-dienyl)ethanimine.
| Compound Name | 1-(6-methyl-4-bicyclo[5.1.0]octa-2,4-dienyl)ethanimine |
|---|---|
| PubChem CID | 91246055 |
| Molecular Formula | C11H14N+ |
| Molecular Weight | 160.24 g/mol |
| Exact Mass | 160.11 |
| IUPAC Name | 1-(6-methyl-4-bicyclo[5.1.0]octa-2,4-dienyl)ethanimine |
| SMILES | [H]/N=C(\C)C1=CC([CH2+])C2CC2C=C1 |
| InChI | InChI=1S/C11H14N/c1-7-5-9(8(2)12)3-4-10-6-11(7)10/h3-5,7,10-12H,1,6H2,2H3/q+1/b12-8+ |
| InChIKey | SGNHIDIPUPVEDR-XYOKQWHBSA-N |
| XLogP | 2.61 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.24 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|