C22H22F2N6O2S — CID 91032710
1-(2,6-difluorophenyl)-3-[3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1,3-thiazolidin-5-ylidene]urea (PubChem CID 91032710) has the molecular formula C22H22F2N6O2S and a molecular weight of 472.52 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-[3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1,3-thiazolidin-5-ylidene]urea.
| Compound Name | 1-(2,6-difluorophenyl)-3-[3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1,3-thiazolidin-5-ylidene]urea |
|---|---|
| PubChem CID | 91032710 |
| Molecular Formula | C22H22F2N6O2S |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.15 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-[3-[6-(morpholin-4-ylmethyl)-1H-benzimidazol-2-yl]-1,3-thiazolidin-5-ylidene]urea |
| SMILES | O=C(N=C1CN(c2nc3ccc(CN4CCOCC4)cc3[nH]2)CS1)Nc1c(F)cccc1F |
| InChI | InChI=1S/C22H22F2N6O2S/c23-15-2-1-3-16(24)20(15)28-22(31)27-19-12-30(13-33-19)21-25-17-5-4-14(10-18(17)26-21)11-29-6-8-32-9-7-29/h1-5,10H,6-9,11-13H2,(H,25,26)(H,28,31) |
| InChIKey | NAMWBJYRNVNMKF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 85.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|