C18H17ClF2N2O2 — CID 9103280
2-[3-chloro-4-(difluoromethoxy)anilino]-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethanone (PubChem CID 9103280) has the molecular formula C18H17ClF2N2O2 and a molecular weight of 366.80 g/mol. Its IUPAC name is 2-[3-chloro-4-(difluoromethoxy)anilino]-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethanone.
| Compound Name | 2-[3-chloro-4-(difluoromethoxy)anilino]-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethanone |
|---|---|
| PubChem CID | 9103280 |
| Molecular Formula | C18H17ClF2N2O2 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 2-[3-chloro-4-(difluoromethoxy)anilino]-1-[(2S)-2-methyl-2,3-dihydroindol-1-yl]ethanone |
| SMILES | C[C@H]1Cc2ccccc2N1C(=O)CNc1ccc(OC(F)F)c(Cl)c1 |
| InChI | InChI=1S/C18H17ClF2N2O2/c1-11-8-12-4-2-3-5-15(12)23(11)17(24)10-22-13-6-7-16(14(19)9-13)25-18(20)21/h2-7,9,11,18,22H,8,10H2,1H3/t11-/m0/s1 |
| InChIKey | AACNHTUVYAHQDW-NSHDSACASA-N |
| XLogP | 4.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|