About N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate
N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate (PubChem CID 91033132) has the molecular formula C18H27NO5
and a molecular weight of 337.42 g/mol. Its IUPAC name is N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate.
Molecular Properties
| Compound Name | N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate |
| PubChem CID | 91033132 |
| Molecular Formula | C18H27NO5 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate |
| SMILES | CCCCNC(C)=O.COC(=O)CCC(=O)COc1ccccc1 |
| InChI | InChI=1S/C12H14O4.C6H13NO/c1-15-12(14)8-7-10(13)9-16-11-5-3-2-4-6-11;1-3-4-5-7-6(2)8/h2-6H,7-9H2,1H3;3-5H2,1-2H3,(H,7,8) |
| InChIKey | CPVCUPMPICMCNL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate?
The IUPAC name of N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate (CID 91033132) is N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate.
What is the SMILES notation for N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate?
The canonical SMILES for N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate is CCCCNC(C)=O.COC(=O)CCC(=O)COc1ccccc1.
What is the InChIKey of N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate?
The InChIKey is CPVCUPMPICMCNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4.C6H13NO/c1-15-12(14)8-7-10(13)9-16-11-5-3-2-4-6-11;1-3-4-5-7-6(2)8/h2-6H,7-9H2,1H3;3-5H2,1-2H3,(H,7,8).
What are the key properties of N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate?
N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate has a molecular weight of 337.42 g/mol, XLogP of 2.51, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-butylacetamide;methyl 4-oxo-5-phenoxypentanoate is sourced from PubChem (CID 91033132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).