C12H12N2O2 — CID 91034197
4-methyl-1-(7-methyl-1,3-benzodioxol-4-yl)imidazole (PubChem CID 91034197) has the molecular formula C12H12N2O2 and a molecular weight of 216.24 g/mol. Its IUPAC name is 4-methyl-1-(7-methyl-1,3-benzodioxol-4-yl)imidazole.
| Compound Name | 4-methyl-1-(7-methyl-1,3-benzodioxol-4-yl)imidazole |
|---|---|
| PubChem CID | 91034197 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 4-methyl-1-(7-methyl-1,3-benzodioxol-4-yl)imidazole |
| SMILES | Cc1cn(-c2ccc(C)c3c2OCO3)cn1 |
| InChI | InChI=1S/C12H12N2O2/c1-8-3-4-10(12-11(8)15-7-16-12)14-5-9(2)13-6-14/h3-6H,7H2,1-2H3 |
| InChIKey | PLBGPBRXTFRUDC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |