C16H32O7 — CID 91034449
3-(2-methoxyethoxymethyl)-16-methyl-1,4,7,10,13-pentaoxacyclohexadecane (PubChem CID 91034449) has the molecular formula C16H32O7 and a molecular weight of 336.43 g/mol. Its IUPAC name is 3-(2-methoxyethoxymethyl)-16-methyl-1,4,7,10,13-pentaoxacyclohexadecane.
| Compound Name | 3-(2-methoxyethoxymethyl)-16-methyl-1,4,7,10,13-pentaoxacyclohexadecane |
|---|---|
| PubChem CID | 91034449 |
| Molecular Formula | C16H32O7 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | 3-(2-methoxyethoxymethyl)-16-methyl-1,4,7,10,13-pentaoxacyclohexadecane |
| SMILES | COCCOCC1COC(C)CCOCCOCCOCCO1 |
| InChI | InChI=1S/C16H32O7/c1-15-3-4-18-7-8-19-9-10-20-11-12-22-16(14-23-15)13-21-6-5-17-2/h15-16H,3-14H2,1-2H3 |
| InChIKey | YNVFXEBLTOTQRU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|