C23H22ClN3O2 — CID 9103465
2-[[2-(3-chloroanilino)-2-oxoethyl]amino]-N-(2-phenylethyl)benzamide (PubChem CID 9103465) has the molecular formula C23H22ClN3O2 and a molecular weight of 407.90 g/mol. Its IUPAC name is 2-[[2-(3-chloroanilino)-2-oxoethyl]amino]-N-(2-phenylethyl)benzamide.
| Compound Name | 2-[[2-(3-chloroanilino)-2-oxoethyl]amino]-N-(2-phenylethyl)benzamide |
|---|---|
| PubChem CID | 9103465 |
| Molecular Formula | C23H22ClN3O2 |
| Molecular Weight | 407.90 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | 2-[[2-(3-chloroanilino)-2-oxoethyl]amino]-N-(2-phenylethyl)benzamide |
| SMILES | O=C(CNc1ccccc1C(=O)NCCc1ccccc1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C23H22ClN3O2/c24-18-9-6-10-19(15-18)27-22(28)16-26-21-12-5-4-11-20(21)23(29)25-14-13-17-7-2-1-3-8-17/h1-12,15,26H,13-14,16H2,(H,25,29)(H,27,28) |
| InChIKey | XDJXZIKPFXHKFF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.90 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |