C35H45FN4O3 — CID 91034720
N-cyclopentyl-3-[4-[4-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-3,5-dimethylphenoxy]-3-methoxyphenyl]propanamide (PubChem CID 91034720) has the molecular formula C35H45FN4O3 and a molecular weight of 588.77 g/mol. Its IUPAC name is N-cyclopentyl-3-[4-[4-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-3,5-dimethylphenoxy]-3-methoxyphenyl]propanamide.
| Compound Name | N-cyclopentyl-3-[4-[4-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-3,5-dimethylphenoxy]-3-methoxyphenyl]propanamide |
|---|---|
| PubChem CID | 91034720 |
| Molecular Formula | C35H45FN4O3 |
| Molecular Weight | 588.77 g/mol |
| Exact Mass | 588.35 |
| IUPAC Name | N-cyclopentyl-3-[4-[4-[4-(3,4-dimethylpiperazin-1-yl)-3-fluoroanilino]-3,5-dimethylphenoxy]-3-methoxyphenyl]propanamide |
| SMILES | COc1cc(CCC(=O)NC2CCCC2)ccc1Oc1cc(C)c(Nc2ccc(N3CCN(C)C(C)C3)c(F)c2)c(C)c1 |
| InChI | InChI=1S/C35H45FN4O3/c1-23-18-29(43-32-14-10-26(20-33(32)42-5)11-15-34(41)37-27-8-6-7-9-27)19-24(2)35(23)38-28-12-13-31(30(36)21-28)40-17-16-39(4)25(3)22-40/h10,12-14,18-21,25,27,38H,6-9,11,15-17,22H2,1-5H3,(H,37,41) |
| InChIKey | DXMPNZOYRIPCMU-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 66.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.77 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|