C18H14F3NO4 — CID 91035534
1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylic acid (PubChem CID 91035534) has the molecular formula C18H14F3NO4 and a molecular weight of 365.31 g/mol. Its IUPAC name is 1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylic acid.
| Compound Name | 1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylic acid |
|---|---|
| PubChem CID | 91035534 |
| Molecular Formula | C18H14F3NO4 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-hydroxy-7-methyl-2-[[4-(trifluoromethoxy)phenyl]methyl]isoindole-5-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc2cn(Cc3ccc(OC(F)(F)F)cc3)c(O)c12 |
| InChI | InChI=1S/C18H14F3NO4/c1-10-6-12(17(24)25)7-13-9-22(16(23)15(10)13)8-11-2-4-14(5-3-11)26-18(19,20)21/h2-7,9,23H,8H2,1H3,(H,24,25) |
| InChIKey | QZJCOEAYITVERK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |