C11H17NO2 — CID 91035668
2-[4-[(2R)-2-aminopropyl]phenyl]ethane-1,1-diol (PubChem CID 91035668) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-[4-[(2R)-2-aminopropyl]phenyl]ethane-1,1-diol.
| Compound Name | 2-[4-[(2R)-2-aminopropyl]phenyl]ethane-1,1-diol |
|---|---|
| PubChem CID | 91035668 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-[4-[(2R)-2-aminopropyl]phenyl]ethane-1,1-diol |
| SMILES | C[C@@H](N)Cc1ccc(CC(O)O)cc1 |
| InChI | InChI=1S/C11H17NO2/c1-8(12)6-9-2-4-10(5-3-9)7-11(13)14/h2-5,8,11,13-14H,6-7,12H2,1H3/t8-/m1/s1 |
| InChIKey | XOQKUGQWCBDJRK-MRVPVSSYSA-N |
| XLogP | 0.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|